bvam1a3rtbubbiedivan bvam1a3rtbubbiedivan

01-03-2017
Biology

contestada

A change in the genetic material is

Respuesta :

laytonjacob09 laytonjacob09

01-03-2017

Mutation: Change in Genetic Material.

Answer Link

atate813 atate813

01-03-2017

causes a permanent change in the genetic material (DNA)

Answer Link

Otras preguntas

What was the Atlantic Charter? A. an agreement made at the Yalta Conference between Roosevelt, Churchill and Stalin to divide up Germany after the war B. an a

How is water necessary for the structure of a green plant?

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

what is the height of the lamp-post using the options ?

What was the "porfiriato"? a. a period in mexican history marked by the dictatorship of porfirio diaz and his wide spread corruption b. a period in mexican hist

youre considering career options in the health field. which of the following would specialize on helping patients recovering from illness with pain management?

The material that formed the solar system originated from a solar ____________________. (1 point)

In writing prose how can you make sure that readers have a clear understanding of your meaning

What is the sum of the arithmetic series 18 sigma t=1 (5t-4) A. 783 B. 1,566 C. 819 D. 86

Brainliest!!!!!!!!!!!!!!!!!!