netoisbeautiful6887 netoisbeautiful6887

04-06-2018
Mathematics

contestada

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Respuesta :

Аноним Аноним

04-06-2018

We use the identity sin (A - B) = sin A cos B - cos B sin A

so the above = sin (11pi/12 - pi/6) = sin 3pi/4 = 1 / sqrt2 answer

Answer Link

Otras preguntas

How was the legislature organized in Virginia and in New Jersey

Find the x- and y-intercept of the line. –10x – 6y = 120

In the electoral college, what formula was utilized to set the number of electors?

An example of a location that directly shows government in action is a

What causes chemical weathering? a. damage caused by animals and plants c. natural acids b. ice wedging d. physical factors

What power is denied to both state and federal governments? a. road building b. coining money c. denying people the right to vote based on race, color, or ge

11. What is a disease that can be caused by a virus or bacteria? influenza pneumonia strep throat common cold 12. This cancer treatment uses chemicals to kill c

The cost of 4 cartons of fresh cream is $7.96. What is the cost of 14 such cartons? $15.99 $21.96 $24.56 $27.86

how do the characters from the golden goblet look

Tasheka quinn is buying a new couch for $989. she made a down payment of 20% and financed the remainder. what amount did she finance? $791.20 $768.00 $789.00 $7