nihyahvelez9 nihyahvelez9

04-07-2020
English

contestada

Based on the word root, which word means “an official announcement”? autocrat credo interdict geodesic

Respuesta :

jemontie1914 jemontie1914

08-09-2020

Answer:

C. interdict

Explanation:

The root word "dict" means say/speak.

Answer Link

mnguyenvobroekma24 mnguyenvobroekma24

20-01-2022

Answer:

it is c

Explanation:

took the test

Answer Link

Otras preguntas

A group of scientist wants to test the effects of increased ocean acidity on a population of Coral. What result from this experiment would show natural selectio

In what 2 states did the fighting first occur between the British and the American colonists?

Use similar triangles and the fact that corresponding sides are proportional to find the length of the side marked with an x (in meters).

PLZ HELP! WILL GIVE BRANLIEST! God's promise to _______________ that his descendants would inherit the land of Canaan is the origin of Judaism. Joseph Jaco

what are the structures found in a root hair cell of a plant?

cosec(6b+pi/8)=sec(2b-pi/8)

Indicate if each verb form is the present or preterite. decimos Question 16 options: presente pretérito

Use the equation y=s x 4 −16 s 3 y=sx4−16s3 to answer the question. How can you rewrite the given formula to correctly isolate x x ? Having trouble understandin

how many miles are there in 20g of KClO3 (k=39 Cl=35.5 O=16)

Explain why is there no chemical equation to describe what happens when water evaporates?